Test Index

NCERT Class XI Chemistry Equilibrium Solutions

© examsnet.com
Question : 52 of 73
Marks: +1, -0
What is the pH of 0.001 M aniline solution? The ionization constant of aniline is 4.27 × 101010^{-10}. Calculate the degree of ionization of aniline in the solution. Also calculate the ionization constant of the conjugate acid of aniline.
Solution:  
C6H5NH2+H2O\mathrm{C_6H_5NH_2}+\mathrm{H_2O}C6H5NH3++OH\mathrm{C_6H_5NH_3^+}+\mathrm{OH^-}
KbK_b = [C6H5NH3+][OH][C6H5NH2]\frac{[\mathrm{C_6H_5NH_3^+}][\mathrm{OH^-}]}{[\mathrm{C_6H_5NH_2}]} = [OH]2[C6H5NH2]\frac{[\mathrm{OH^-}]^2}{[\mathrm{C_6H_5NH_2}]}
[OH][\mathrm{OH^-}] = Kb[C6H5NH2]\sqrt{K_b[\mathrm{C_6H_5NH_2}]} = (4.27×1010)(103)\sqrt{(4.27\times 10^{-10})(10^{-3})} = 6.534 × 107M10^{-7}\,\mathrm{M}
pOH = - log (6.534 × 107)10^{-7}) = 6.18
∴ pH = 14 - 6.18 = 7.82
C6H5NH2+H2O\mathrm{C_6H_5NH_2}+\mathrm{H_2O}C6H5NH3++OH\mathrm{C_6H_5NH_3^+}+\mathrm{OH^-}
InitialC00At eqm.CCαCαCα\begin{array}{lccc}\text{Initial} & C & 0 & 0 \\ \text{At eqm.} & C-C\alpha & C\alpha & C\alpha \end{array}
KbK_b = CαCαC(1α)\frac{C\alpha \cdot C\alpha}{C(1-\alpha)} = Cα21α\frac{C\alpha^2}{1-\alpha} = Cα2C\alpha^2 (Since 1 ⋙ α)
∴ α = KbC\sqrt{\frac{K_b}{C}} = 4.27×1010103\sqrt{\frac{4.27\times 10^{-10}}{10^{-3}}} = 6.53 × 10410^{-4}
pKbpK_b = –log(4.27 × 101010^{-10}) = 9.37
pKa+pKbpK_a + pK_b = 14 (for a pair of conjugate acid and base)
pKapK_a = 14 – 9.37 = 4.63
i.e. –log KaK_a = 4.63 or, log KaK_a = –4.63
or, KaK_a = antilog(–4.63) = 2.34 × 10510^{-5}
pH = 7.82, a = 6.53 × 10410^{-4}, KaK_a = 2.34 × 10510^{-5}
© examsnet.com
Go to Question: